C22H23F3O4 — CID 91719153
1-O-heptyl 2-O-[(2,3,6-trifluorophenyl)methyl] benzene-1,2-dicarboxylate (PubChem CID 91719153) has the molecular formula C22H23F3O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is 1-O-heptyl 2-O-[(2,3,6-trifluorophenyl)methyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-heptyl 2-O-[(2,3,6-trifluorophenyl)methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91719153 |
| Molecular Formula | C22H23F3O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-O-heptyl 2-O-[(2,3,6-trifluorophenyl)methyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccccc1C(=O)OCc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C22H23F3O4/c1-2-3-4-5-8-13-28-21(26)15-9-6-7-10-16(15)22(27)29-14-17-18(23)11-12-19(24)20(17)25/h6-7,9-12H,2-5,8,13-14H2,1H3 |
| InChIKey | AKODANXSUACKPU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|