C19H17F3O4 — CID 91719150
1-O-butyl 2-O-[(2,3,6-trifluorophenyl)methyl] benzene-1,2-dicarboxylate (PubChem CID 91719150) has the molecular formula C19H17F3O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is 1-O-butyl 2-O-[(2,3,6-trifluorophenyl)methyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-butyl 2-O-[(2,3,6-trifluorophenyl)methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91719150 |
| Molecular Formula | C19H17F3O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-O-butyl 2-O-[(2,3,6-trifluorophenyl)methyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C19H17F3O4/c1-2-3-10-25-18(23)12-6-4-5-7-13(12)19(24)26-11-14-15(20)8-9-16(21)17(14)22/h4-9H,2-3,10-11H2,1H3 |
| InChIKey | HNPHUIWFJJXUSI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|