C15H10Cl3NO3 — CID 2798263
(2,4-dichlorophenyl)methyl N-(2-chlorobenzoyl)carbamate (PubChem CID 2798263) has the molecular formula C15H10Cl3NO3 and a molecular weight of 358.61 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl N-(2-chlorobenzoyl)carbamate.
| Compound Name | (2,4-dichlorophenyl)methyl N-(2-chlorobenzoyl)carbamate |
|---|---|
| PubChem CID | 2798263 |
| Molecular Formula | C15H10Cl3NO3 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | (2,4-dichlorophenyl)methyl N-(2-chlorobenzoyl)carbamate |
| SMILES | O=C(NC(=O)c1ccccc1Cl)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl3NO3/c16-10-6-5-9(13(18)7-10)8-22-15(21)19-14(20)11-3-1-2-4-12(11)17/h1-7H,8H2,(H,19,20,21) |
| InChIKey | VBSRSSXEXYRMPQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |