C21H16Cl2N2O3 — CID 70576608
2-chloro-N-[[3-chloro-4-(phenoxymethyl)phenyl]carbamoyl]benzamide (PubChem CID 70576608) has the molecular formula C21H16Cl2N2O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is 2-chloro-N-[[3-chloro-4-(phenoxymethyl)phenyl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[3-chloro-4-(phenoxymethyl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 70576608 |
| Molecular Formula | C21H16Cl2N2O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 2-chloro-N-[[3-chloro-4-(phenoxymethyl)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1ccc(COc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O3/c22-18-9-5-4-8-17(18)20(26)25-21(27)24-15-11-10-14(19(23)12-15)13-28-16-6-2-1-3-7-16/h1-12H,13H2,(H2,24,25,26,27) |
| InChIKey | YINQTPRWMOUZOO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |