C20H14Cl2N2O2 — CID 134092649
2-chloro-N-[(3-chloro-4-phenylphenyl)carbamoyl]benzamide (PubChem CID 134092649) has the molecular formula C20H14Cl2N2O2 and a molecular weight of 385.25 g/mol. Its IUPAC name is 2-chloro-N-[(3-chloro-4-phenylphenyl)carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[(3-chloro-4-phenylphenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 134092649 |
| Molecular Formula | C20H14Cl2N2O2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-chloro-N-[(3-chloro-4-phenylphenyl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1ccc(-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2N2O2/c21-17-9-5-4-8-16(17)19(25)24-20(26)23-14-10-11-15(18(22)12-14)13-6-2-1-3-7-13/h1-12H,(H2,23,24,25,26) |
| InChIKey | HCGFZJPMHFVDTP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |