C26H19ClN2O5S — CID 134107386
[4-[(2-chlorobenzoyl)carbamoylamino]-2-phenylphenyl] benzenesulfonate (PubChem CID 134107386) has the molecular formula C26H19ClN2O5S and a molecular weight of 506.97 g/mol. Its IUPAC name is [4-[(2-chlorobenzoyl)carbamoylamino]-2-phenylphenyl] benzenesulfonate.
| Compound Name | [4-[(2-chlorobenzoyl)carbamoylamino]-2-phenylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 134107386 |
| Molecular Formula | C26H19ClN2O5S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | [4-[(2-chlorobenzoyl)carbamoylamino]-2-phenylphenyl] benzenesulfonate |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1ccc(OS(=O)(=O)c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H19ClN2O5S/c27-23-14-8-7-13-21(23)25(30)29-26(31)28-19-15-16-24(22(17-19)18-9-3-1-4-10-18)34-35(32,33)20-11-5-2-6-12-20/h1-17H,(H2,28,29,30,31) |
| InChIKey | WCYRXBLFAVFJQP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|