C33H36N2O7S2 — CID 142536499
[4-[[4-(benzenesulfonyloxy)-3-tert-butylphenyl]carbamoylamino]-2-tert-butylphenyl] benzenesulfonate (PubChem CID 142536499) has the molecular formula C33H36N2O7S2 and a molecular weight of 636.79 g/mol. Its IUPAC name is [4-[[4-(benzenesulfonyloxy)-3-tert-butylphenyl]carbamoylamino]-2-tert-butylphenyl] benzenesulfonate.
| Compound Name | [4-[[4-(benzenesulfonyloxy)-3-tert-butylphenyl]carbamoylamino]-2-tert-butylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 142536499 |
| Molecular Formula | C33H36N2O7S2 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | [4-[[4-(benzenesulfonyloxy)-3-tert-butylphenyl]carbamoylamino]-2-tert-butylphenyl] benzenesulfonate |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(OS(=O)(=O)c3ccccc3)c(C(C)(C)C)c2)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H36N2O7S2/c1-32(2,3)27-21-23(17-19-29(27)41-43(37,38)25-13-9-7-10-14-25)34-31(36)35-24-18-20-30(28(22-24)33(4,5)6)42-44(39,40)26-15-11-8-12-16-26/h7-22H,1-6H3,(H2,34,35,36) |
| InChIKey | HNELCCALSVMNOU-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|