C22H20N2O7S — CID 168860625
methyl 2-(4-methoxyphenyl)sulfonyloxy-4-(phenylcarbamoylamino)benzoate (PubChem CID 168860625) has the molecular formula C22H20N2O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is methyl 2-(4-methoxyphenyl)sulfonyloxy-4-(phenylcarbamoylamino)benzoate.
| Compound Name | methyl 2-(4-methoxyphenyl)sulfonyloxy-4-(phenylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 168860625 |
| Molecular Formula | C22H20N2O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | methyl 2-(4-methoxyphenyl)sulfonyloxy-4-(phenylcarbamoylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Nc2ccccc2)cc1OS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H20N2O7S/c1-29-17-9-11-18(12-10-17)32(27,28)31-20-14-16(8-13-19(20)21(25)30-2)24-22(26)23-15-6-4-3-5-7-15/h3-14H,1-2H3,(H2,23,24,26) |
| InChIKey | LVSAFKCYDSHYBT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|