C14H10Cl4N2O2 — CID 91682789
3,5-dichloro-4-[(2,4-dichlorophenyl)methoxy]benzohydrazide (PubChem CID 91682789) has the molecular formula C14H10Cl4N2O2 and a molecular weight of 380.06 g/mol. Its IUPAC name is 3,5-dichloro-4-[(2,4-dichlorophenyl)methoxy]benzohydrazide.
| Compound Name | 3,5-dichloro-4-[(2,4-dichlorophenyl)methoxy]benzohydrazide |
|---|---|
| PubChem CID | 91682789 |
| Molecular Formula | C14H10Cl4N2O2 |
| Molecular Weight | 380.06 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 3,5-dichloro-4-[(2,4-dichlorophenyl)methoxy]benzohydrazide |
| SMILES | NNC(=O)c1cc(Cl)c(OCc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl4N2O2/c15-9-2-1-7(10(16)5-9)6-22-13-11(17)3-8(4-12(13)18)14(21)20-19/h1-5H,6,19H2,(H,20,21) |
| InChIKey | UJLHEUUMBXEQBD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.06 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|