C15H12Cl2N2O2S — CID 132591174
N-carbamothioyl-4-[(2,4-dichlorophenyl)methoxy]benzamide (PubChem CID 132591174) has the molecular formula C15H12Cl2N2O2S and a molecular weight of 355.25 g/mol. Its IUPAC name is N-carbamothioyl-4-[(2,4-dichlorophenyl)methoxy]benzamide.
| Compound Name | N-carbamothioyl-4-[(2,4-dichlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 132591174 |
| Molecular Formula | C15H12Cl2N2O2S |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | N-carbamothioyl-4-[(2,4-dichlorophenyl)methoxy]benzamide |
| SMILES | NC(=S)NC(=O)c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2N2O2S/c16-11-4-1-10(13(17)7-11)8-21-12-5-2-9(3-6-12)14(20)19-15(18)22/h1-7H,8H2,(H3,18,19,20,22) |
| InChIKey | PUIJIVJFYAZWEG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|