C25H24Cl2N2O3 — CID 51061552
N-[(E)-(4-butoxyphenyl)methylideneamino]-4-[(2,4-dichlorophenyl)methoxy]benzamide (PubChem CID 51061552) has the molecular formula C25H24Cl2N2O3 and a molecular weight of 471.38 g/mol. Its IUPAC name is N-[(E)-(4-butoxyphenyl)methylideneamino]-4-[(2,4-dichlorophenyl)methoxy]benzamide.
| Compound Name | N-[(E)-(4-butoxyphenyl)methylideneamino]-4-[(2,4-dichlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 51061552 |
| Molecular Formula | C25H24Cl2N2O3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[(E)-(4-butoxyphenyl)methylideneamino]-4-[(2,4-dichlorophenyl)methoxy]benzamide |
| SMILES | CCCCOc1ccc(/C=N/NC(=O)c2ccc(OCc3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O3/c1-2-3-14-31-22-10-4-18(5-11-22)16-28-29-25(30)19-7-12-23(13-8-19)32-17-20-6-9-21(26)15-24(20)27/h4-13,15-16H,2-3,14,17H2,1H3,(H,29,30)/b28-16+ |
| InChIKey | ZREIADNPLUPQBK-LQKURTRISA-N |
| XLogP | 6.52 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|