C22H22Cl2N4O2 — CID 51388939
N-[(Z)-(4-butoxyphenyl)methylideneamino]-1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 51388939) has the molecular formula C22H22Cl2N4O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is N-[(Z)-(4-butoxyphenyl)methylideneamino]-1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(4-butoxyphenyl)methylideneamino]-1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51388939 |
| Molecular Formula | C22H22Cl2N4O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[(Z)-(4-butoxyphenyl)methylideneamino]-1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | CCCCOc1ccc(/C=N\NC(=O)c2ccn(Cc3ccc(Cl)cc3Cl)n2)cc1 |
| InChI | InChI=1S/C22H22Cl2N4O2/c1-2-3-12-30-19-8-4-16(5-9-19)14-25-26-22(29)21-10-11-28(27-21)15-17-6-7-18(23)13-20(17)24/h4-11,13-14H,2-3,12,15H2,1H3,(H,26,29)/b25-14- |
| InChIKey | OFCRZQVRKHBWTG-QFEZKATASA-N |
| XLogP | 5.18 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|