C19H21ClN2O2 — CID 7782249
2-chloro-N-[(Z)-(4-pentoxyphenyl)methylideneamino]benzamide (PubChem CID 7782249) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-(4-pentoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[(Z)-(4-pentoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 7782249 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-chloro-N-[(Z)-(4-pentoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCCCOc1ccc(/C=N\NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-2-3-6-13-24-16-11-9-15(10-12-16)14-21-22-19(23)17-7-4-5-8-18(17)20/h4-5,7-12,14H,2-3,6,13H2,1H3,(H,22,23)/b21-14- |
| InChIKey | BSYCGZOOSUMZTF-STZFKDTASA-N |
| XLogP | 4.67 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|