C26H36N2O3 — CID 162378074
N-(benzylideneamino)-2,4-dihexoxybenzamide (PubChem CID 162378074) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-(benzylideneamino)-2,4-dihexoxybenzamide.
| Compound Name | N-(benzylideneamino)-2,4-dihexoxybenzamide |
|---|---|
| PubChem CID | 162378074 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-(benzylideneamino)-2,4-dihexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NN=Cc2ccccc2)c(OCCCCCC)c1 |
| InChI | InChI=1S/C26H36N2O3/c1-3-5-7-12-18-30-23-16-17-24(25(20-23)31-19-13-8-6-4-2)26(29)28-27-21-22-14-10-9-11-15-22/h9-11,14-17,20-21H,3-8,12-13,18-19H2,1-2H3,(H,28,29) |
| InChIKey | KMRGRDDYBGZWBR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|