C34H44N4O4S — CID 44517027
2-N,5-N-bis[(Z)-benzylideneamino]-3,4-diheptoxythiophene-2,5-dicarboxamide (PubChem CID 44517027) has the molecular formula C34H44N4O4S and a molecular weight of 604.82 g/mol. Its IUPAC name is 2-N,5-N-bis[(Z)-benzylideneamino]-3,4-diheptoxythiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(Z)-benzylideneamino]-3,4-diheptoxythiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 44517027 |
| Molecular Formula | C34H44N4O4S |
| Molecular Weight | 604.82 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | 2-N,5-N-bis[(Z)-benzylideneamino]-3,4-diheptoxythiophene-2,5-dicarboxamide |
| SMILES | CCCCCCCOc1c(C(=O)N/N=C\c2ccccc2)sc(C(=O)N/N=C\c2ccccc2)c1OCCCCCCC |
| InChI | InChI=1S/C34H44N4O4S/c1-3-5-7-9-17-23-41-29-30(42-24-18-10-8-6-4-2)32(34(40)38-36-26-28-21-15-12-16-22-28)43-31(29)33(39)37-35-25-27-19-13-11-14-20-27/h11-16,19-22,25-26H,3-10,17-18,23-24H2,1-2H3,(H,37,39)(H,38,40)/b35-25-,36-26- |
| InChIKey | NHUJYEXILHTGFZ-SDURLSCFSA-N |
| XLogP | 7.97 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.82 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|