C30H30N6O4S — CID 135867861
2-N,5-N-bis[(E)-1H-indol-3-ylmethylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide (PubChem CID 135867861) has the molecular formula C30H30N6O4S and a molecular weight of 570.68 g/mol. Its IUPAC name is 2-N,5-N-bis[(E)-1H-indol-3-ylmethylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(E)-1H-indol-3-ylmethylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 135867861 |
| Molecular Formula | C30H30N6O4S |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 2-N,5-N-bis[(E)-1H-indol-3-ylmethylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide |
| SMILES | CCCOc1c(C(=O)N/N=C/c2c[nH]c3ccccc23)sc(C(=O)N/N=C/c2c[nH]c3ccccc23)c1OCCC |
| InChI | InChI=1S/C30H30N6O4S/c1-3-13-39-25-26(40-14-4-2)28(30(38)36-34-18-20-16-32-24-12-8-6-10-22(20)24)41-27(25)29(37)35-33-17-19-15-31-23-11-7-5-9-21(19)23/h5-12,15-18,31-32H,3-4,13-14H2,1-2H3,(H,35,37)(H,36,38)/b33-17+,34-18+ |
| InChIKey | ODXKKWVNIONGDF-WMFSDKRHSA-N |
| XLogP | 5.82 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|