C24H28N8O4S — CID 44516695
2-N,5-N-bis[(Z)-(2-amino-3-pyridinyl)methylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide (PubChem CID 44516695) has the molecular formula C24H28N8O4S and a molecular weight of 524.61 g/mol. Its IUPAC name is 2-N,5-N-bis[(Z)-(2-amino-3-pyridinyl)methylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(Z)-(2-amino-3-pyridinyl)methylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 44516695 |
| Molecular Formula | C24H28N8O4S |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-N,5-N-bis[(Z)-(2-amino-3-pyridinyl)methylideneamino]-3,4-dipropoxythiophene-2,5-dicarboxamide |
| SMILES | CCCOc1c(C(=O)N/N=C\c2cccnc2N)sc(C(=O)N/N=C\c2cccnc2N)c1OCCC |
| InChI | InChI=1S/C24H28N8O4S/c1-3-11-35-17-18(36-12-4-2)20(24(34)32-30-14-16-8-6-10-28-22(16)26)37-19(17)23(33)31-29-13-15-7-5-9-27-21(15)25/h5-10,13-14H,3-4,11-12H2,1-2H3,(H2,25,27)(H2,26,28)(H,31,33)(H,32,34)/b29-13-,30-14- |
| InChIKey | RWIWIKOMTBPWOM-VVAFTLCXSA-N |
| XLogP | 2.81 |
| TPSA | 179.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|