C19H14N4OS — CID 54585208
3-amino-N-[(E)-naphthalen-1-ylmethylideneamino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 54585208) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is 3-amino-N-[(E)-naphthalen-1-ylmethylideneamino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(E)-naphthalen-1-ylmethylideneamino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 54585208 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3-amino-N-[(E)-naphthalen-1-ylmethylideneamino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)N/N=C/c2cccc3ccccc23)sc2ncccc12 |
| InChI | InChI=1S/C19H14N4OS/c20-16-15-9-4-10-21-19(15)25-17(16)18(24)23-22-11-13-7-3-6-12-5-1-2-8-14(12)13/h1-11H,20H2,(H,23,24)/b22-11+ |
| InChIKey | ZPRGXCVIVGKQTM-SSDVNMTOSA-N |
| XLogP | 3.80 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|