C11H13N5O2S — CID 83117309
3-amino-N-[2-(carbamoylamino)ethyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 83117309) has the molecular formula C11H13N5O2S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3-amino-N-[2-(carbamoylamino)ethyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[2-(carbamoylamino)ethyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 83117309 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-amino-N-[2-(carbamoylamino)ethyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)NCCNC(=O)c1sc2ncccc2c1N |
| InChI | InChI=1S/C11H13N5O2S/c12-7-6-2-1-3-15-10(6)19-8(7)9(17)14-4-5-16-11(13)18/h1-3H,4-5,12H2,(H,14,17)(H3,13,16,18) |
| InChIKey | HEPQEIQCNGEDBF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|