C13H16N4OS — CID 83025024
3-amino-N-piperidin-1-ylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 83025024) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-amino-N-piperidin-1-ylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-piperidin-1-ylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 83025024 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-amino-N-piperidin-1-ylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)NN2CCCCC2)sc2ncccc12 |
| InChI | InChI=1S/C13H16N4OS/c14-10-9-5-4-6-15-13(9)19-11(10)12(18)16-17-7-2-1-3-8-17/h4-6H,1-3,7-8,14H2,(H,16,18) |
| InChIKey | HJXLFONUGXEDRL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |