C14H8F3N3OS — CID 41316323
3-amino-N-(2,3,4-trifluorophenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 41316323) has the molecular formula C14H8F3N3OS and a molecular weight of 323.30 g/mol. Its IUPAC name is 3-amino-N-(2,3,4-trifluorophenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(2,3,4-trifluorophenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 41316323 |
| Molecular Formula | C14H8F3N3OS |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 3-amino-N-(2,3,4-trifluorophenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)Nc2ccc(F)c(F)c2F)sc2ncccc12 |
| InChI | InChI=1S/C14H8F3N3OS/c15-7-3-4-8(10(17)9(7)16)20-13(21)12-11(18)6-2-1-5-19-14(6)22-12/h1-5H,18H2,(H,20,21) |
| InChIKey | OSXFXONWFWBOMF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|