C14H13N3O2S — CID 160853346
methyl 3-aminothieno[2,3-b]pyridine-2-carboxylate;pyridine (PubChem CID 160853346) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 3-aminothieno[2,3-b]pyridine-2-carboxylate;pyridine.
| Compound Name | methyl 3-aminothieno[2,3-b]pyridine-2-carboxylate;pyridine |
|---|---|
| PubChem CID | 160853346 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | methyl 3-aminothieno[2,3-b]pyridine-2-carboxylate;pyridine |
| SMILES | COC(=O)c1sc2ncccc2c1N.c1ccncc1 |
| InChI | InChI=1S/C9H8N2O2S.C5H5N/c1-13-9(12)7-6(10)5-3-2-4-11-8(5)14-7;1-2-4-6-5-3-1/h2-4H,10H2,1H3;1-5H |
| InChIKey | SJNYBUFOJMUNND-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |