C17H16N2O2S — CID 156621154
methyl 3-(2-phenylethylamino)thieno[2,3-b]pyridine-2-carboxylate (PubChem CID 156621154) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is methyl 3-(2-phenylethylamino)thieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | methyl 3-(2-phenylethylamino)thieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 156621154 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl 3-(2-phenylethylamino)thieno[2,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1sc2ncccc2c1NCCc1ccccc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-21-17(20)15-14(13-8-5-10-19-16(13)22-15)18-11-9-12-6-3-2-4-7-12/h2-8,10,18H,9,11H2,1H3 |
| InChIKey | OQVYFYLZEFBMQY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |