C20H19ClN2O2 — CID 1181324
ethyl 8-chloro-4-(2-phenylethylamino)quinoline-3-carboxylate (PubChem CID 1181324) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is ethyl 8-chloro-4-(2-phenylethylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 8-chloro-4-(2-phenylethylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1181324 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | ethyl 8-chloro-4-(2-phenylethylamino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(Cl)cccc2c1NCCc1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-2-25-20(24)16-13-23-19-15(9-6-10-17(19)21)18(16)22-12-11-14-7-4-3-5-8-14/h3-10,13H,2,11-12H2,1H3,(H,22,23) |
| InChIKey | YONHHSBSXQBQLC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |