C23H24ClN3O2 — CID 43840467
ethyl 4-(4-benzylpiperazin-1-yl)-8-chloroquinoline-3-carboxylate (PubChem CID 43840467) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is ethyl 4-(4-benzylpiperazin-1-yl)-8-chloroquinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-benzylpiperazin-1-yl)-8-chloroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 43840467 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | ethyl 4-(4-benzylpiperazin-1-yl)-8-chloroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(Cl)cccc2c1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H24ClN3O2/c1-2-29-23(28)19-15-25-21-18(9-6-10-20(21)24)22(19)27-13-11-26(12-14-27)16-17-7-4-3-5-8-17/h3-10,15H,2,11-14,16H2,1H3 |
| InChIKey | JNAOQYICCGBHFP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |