C18H20F3N3O2 — CID 1191908
ethyl 4-(4-methylpiperazin-1-yl)-8-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 1191908) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is ethyl 4-(4-methylpiperazin-1-yl)-8-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-methylpiperazin-1-yl)-8-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1191908 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl 4-(4-methylpiperazin-1-yl)-8-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(C(F)(F)F)cccc2c1N1CCN(C)CC1 |
| InChI | InChI=1S/C18H20F3N3O2/c1-3-26-17(25)13-11-22-15-12(5-4-6-14(15)18(19,20)21)16(13)24-9-7-23(2)8-10-24/h4-6,11H,3,7-10H2,1-2H3 |
| InChIKey | RIQWGWOEFJLURH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |