C21H22N4O2 — CID 133277711
ethyl 4-(4-pyridin-4-ylpiperazin-1-yl)quinoline-3-carboxylate (PubChem CID 133277711) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 4-(4-pyridin-4-ylpiperazin-1-yl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-pyridin-4-ylpiperazin-1-yl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 133277711 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | ethyl 4-(4-pyridin-4-ylpiperazin-1-yl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccccc2c1N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C21H22N4O2/c1-2-27-21(26)18-15-23-19-6-4-3-5-17(19)20(18)25-13-11-24(12-14-25)16-7-9-22-10-8-16/h3-10,15H,2,11-14H2,1H3 |
| InChIKey | WSLOQLMZAOOLQD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |