C24H24FN3O3 — CID 133277748
ethyl 4-[4-[(2-fluorobenzoyl)amino]piperidin-1-yl]quinoline-3-carboxylate (PubChem CID 133277748) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is ethyl 4-[4-[(2-fluorobenzoyl)amino]piperidin-1-yl]quinoline-3-carboxylate.
| Compound Name | ethyl 4-[4-[(2-fluorobenzoyl)amino]piperidin-1-yl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 133277748 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | ethyl 4-[4-[(2-fluorobenzoyl)amino]piperidin-1-yl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccccc2c1N1CCC(NC(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H24FN3O3/c1-2-31-24(30)19-15-26-21-10-6-4-8-18(21)22(19)28-13-11-16(12-14-28)27-23(29)17-7-3-5-9-20(17)25/h3-10,15-16H,2,11-14H2,1H3,(H,27,29) |
| InChIKey | VNIJWABPYAWYSF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |