C21H24FN3O2 — CID 133453618
ethyl 4-(4-but-3-ynylpiperazin-1-yl)-6-fluoro-8-methylquinoline-3-carboxylate (PubChem CID 133453618) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is ethyl 4-(4-but-3-ynylpiperazin-1-yl)-6-fluoro-8-methylquinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-but-3-ynylpiperazin-1-yl)-6-fluoro-8-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 133453618 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethyl 4-(4-but-3-ynylpiperazin-1-yl)-6-fluoro-8-methylquinoline-3-carboxylate |
| SMILES | C#CCCN1CCN(c2c(C(=O)OCC)cnc3c(C)cc(F)cc23)CC1 |
| InChI | InChI=1S/C21H24FN3O2/c1-4-6-7-24-8-10-25(11-9-24)20-17-13-16(22)12-15(3)19(17)23-14-18(20)21(26)27-5-2/h1,12-14H,5-11H2,2-3H3 |
| InChIKey | IMTRIEGNKLCNRY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|