C18H21FN2O3 — CID 133410718
ethyl 6-fluoro-4-(3-hydroxy-3-methylpyrrolidin-1-yl)-8-methylquinoline-3-carboxylate (PubChem CID 133410718) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is ethyl 6-fluoro-4-(3-hydroxy-3-methylpyrrolidin-1-yl)-8-methylquinoline-3-carboxylate.
| Compound Name | ethyl 6-fluoro-4-(3-hydroxy-3-methylpyrrolidin-1-yl)-8-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 133410718 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | ethyl 6-fluoro-4-(3-hydroxy-3-methylpyrrolidin-1-yl)-8-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(C)cc(F)cc2c1N1CCC(C)(O)C1 |
| InChI | InChI=1S/C18H21FN2O3/c1-4-24-17(22)14-9-20-15-11(2)7-12(19)8-13(15)16(14)21-6-5-18(3,23)10-21/h7-9,23H,4-6,10H2,1-3H3 |
| InChIKey | WUTOYKSPNZYQDZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |