C22H20FN5O2 — CID 134154720
ethyl 4-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-6-fluoroquinoline-3-carboxylate (PubChem CID 134154720) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is ethyl 4-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-6-fluoroquinoline-3-carboxylate.
| Compound Name | ethyl 4-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-6-fluoroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 134154720 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | ethyl 4-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-6-fluoroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(F)cc2c1N1CCN(c2ncccc2C#N)CC1 |
| InChI | InChI=1S/C22H20FN5O2/c1-2-30-22(29)18-14-26-19-6-5-16(23)12-17(19)20(18)27-8-10-28(11-9-27)21-15(13-24)4-3-7-25-21/h3-7,12,14H,2,8-11H2,1H3 |
| InChIKey | SVLZNUGVKFIWNW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |