C20H19FN2O3S — CID 133369054
ethyl 6-fluoro-4-(2-thiophen-3-ylmorpholin-4-yl)quinoline-3-carboxylate (PubChem CID 133369054) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl 6-fluoro-4-(2-thiophen-3-ylmorpholin-4-yl)quinoline-3-carboxylate.
| Compound Name | ethyl 6-fluoro-4-(2-thiophen-3-ylmorpholin-4-yl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 133369054 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | ethyl 6-fluoro-4-(2-thiophen-3-ylmorpholin-4-yl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(F)cc2c1N1CCOC(c2ccsc2)C1 |
| InChI | InChI=1S/C20H19FN2O3S/c1-2-25-20(24)16-10-22-17-4-3-14(21)9-15(17)19(16)23-6-7-26-18(11-23)13-5-8-27-12-13/h3-5,8-10,12,18H,2,6-7,11H2,1H3 |
| InChIKey | DMTAMLADAGHUEZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |