C18H17N3O2S — CID 97224305
2-[(2R)-2-thiophen-3-ylmorpholin-4-yl]quinoline-4-carboxamide (PubChem CID 97224305) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[(2R)-2-thiophen-3-ylmorpholin-4-yl]quinoline-4-carboxamide.
| Compound Name | 2-[(2R)-2-thiophen-3-ylmorpholin-4-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 97224305 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-[(2R)-2-thiophen-3-ylmorpholin-4-yl]quinoline-4-carboxamide |
| SMILES | NC(=O)c1cc(N2CCO[C@H](c3ccsc3)C2)nc2ccccc12 |
| InChI | InChI=1S/C18H17N3O2S/c19-18(22)14-9-17(20-15-4-2-1-3-13(14)15)21-6-7-23-16(10-21)12-5-8-24-11-12/h1-5,8-9,11,16H,6-7,10H2,(H2,19,22)/t16-/m0/s1 |
| InChIKey | ZXFCWZSBYKPKKA-INIZCTEOSA-N |
| XLogP | 2.97 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |