C14H14FN3O2 — CID 154817068
2-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]quinoline-4-carboxamide (PubChem CID 154817068) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]quinoline-4-carboxamide.
| Compound Name | 2-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 154817068 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]quinoline-4-carboxamide |
| SMILES | NC(=O)c1cc(N2C[C@@H](O)[C@H](F)C2)nc2ccccc12 |
| InChI | InChI=1S/C14H14FN3O2/c15-10-6-18(7-12(10)19)13-5-9(14(16)20)8-3-1-2-4-11(8)17-13/h1-5,10,12,19H,6-7H2,(H2,16,20)/t10-,12-/m1/s1 |
| InChIKey | HYKFWMIDJOVGIJ-ZYHUDNBSSA-N |
| XLogP | 0.85 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |