C14H16N4O3 — CID 136766529
2-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxyquinoline-4-carboximidamide (PubChem CID 136766529) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxyquinoline-4-carboximidamide.
| Compound Name | 2-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxyquinoline-4-carboximidamide |
|---|---|
| PubChem CID | 136766529 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxyquinoline-4-carboximidamide |
| SMILES | N/C(=N/O)c1cc(N2CC(O)C(O)C2)nc2ccccc12 |
| InChI | InChI=1S/C14H16N4O3/c15-14(17-21)9-5-13(18-6-11(19)12(20)7-18)16-10-4-2-1-3-8(9)10/h1-5,11-12,19-21H,6-7H2,(H2,15,17) |
| InChIKey | VYFFLBDJKCQQPK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|