C15H17N3OS — CID 63885913
2-(3-hydroxypiperidin-1-yl)quinoline-4-carbothioamide (PubChem CID 63885913) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-(3-hydroxypiperidin-1-yl)quinoline-4-carbothioamide.
| Compound Name | 2-(3-hydroxypiperidin-1-yl)quinoline-4-carbothioamide |
|---|---|
| PubChem CID | 63885913 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-(3-hydroxypiperidin-1-yl)quinoline-4-carbothioamide |
| SMILES | NC(=S)c1cc(N2CCCC(O)C2)nc2ccccc12 |
| InChI | InChI=1S/C15H17N3OS/c16-15(20)12-8-14(18-7-3-4-10(19)9-18)17-13-6-2-1-5-11(12)13/h1-2,5-6,8,10,19H,3-4,7,9H2,(H2,16,20) |
| InChIKey | ZWVJHAPANUBOCD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|