C16H20N4O — CID 63883747
2-(2,6-dimethylmorpholin-4-yl)quinoline-4-carboximidamide (PubChem CID 63883747) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)quinoline-4-carboximidamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)quinoline-4-carboximidamide |
|---|---|
| PubChem CID | 63883747 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)quinoline-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(N2CC(C)OC(C)C2)nc2ccccc12 |
| InChI | InChI=1S/C16H20N4O/c1-10-8-20(9-11(2)21-10)15-7-13(16(17)18)12-5-3-4-6-14(12)19-15/h3-7,10-11H,8-9H2,1-2H3,(H3,17,18) |
| InChIKey | RJXRHJQJYFJKMW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|