C16H20N2O — CID 705234
(2S,6S)-2,6-dimethyl-4-(4-methylquinolin-2-yl)morpholine (PubChem CID 705234) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethyl-4-(4-methylquinolin-2-yl)morpholine.
| Compound Name | (2S,6S)-2,6-dimethyl-4-(4-methylquinolin-2-yl)morpholine |
|---|---|
| PubChem CID | 705234 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2S,6S)-2,6-dimethyl-4-(4-methylquinolin-2-yl)morpholine |
| SMILES | Cc1cc(N2C[C@H](C)O[C@@H](C)C2)nc2ccccc12 |
| InChI | InChI=1S/C16H20N2O/c1-11-8-16(17-15-7-5-4-6-14(11)15)18-9-12(2)19-13(3)10-18/h4-8,12-13H,9-10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | QEBPWCVIAFPKFI-STQMWFEESA-N |
| XLogP | 3.16 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |