C16H19ClN2O — CID 104959969
(2R,6S)-4-[4-(chloromethyl)quinolin-2-yl]-2,6-dimethylmorpholine (PubChem CID 104959969) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is (2R,6S)-4-[4-(chloromethyl)quinolin-2-yl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[4-(chloromethyl)quinolin-2-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 104959969 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (2R,6S)-4-[4-(chloromethyl)quinolin-2-yl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2cc(CCl)c3ccccc3n2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H19ClN2O/c1-11-9-19(10-12(2)20-11)16-7-13(8-17)14-5-3-4-6-15(14)18-16/h3-7,11-12H,8-10H2,1-2H3/t11-,12+ |
| InChIKey | YEDRCLWKULSULA-TXEJJXNPSA-N |
| XLogP | 3.59 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|