C17H21ClN2O — CID 63375399
4-[2-(chloromethyl)quinolin-4-yl]-2,2,6-trimethylmorpholine (PubChem CID 63375399) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 4-[2-(chloromethyl)quinolin-4-yl]-2,2,6-trimethylmorpholine.
| Compound Name | 4-[2-(chloromethyl)quinolin-4-yl]-2,2,6-trimethylmorpholine |
|---|---|
| PubChem CID | 63375399 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[2-(chloromethyl)quinolin-4-yl]-2,2,6-trimethylmorpholine |
| SMILES | CC1CN(c2cc(CCl)nc3ccccc23)CC(C)(C)O1 |
| InChI | InChI=1S/C17H21ClN2O/c1-12-10-20(11-17(2,3)21-12)16-8-13(9-18)19-15-7-5-4-6-14(15)16/h4-8,12H,9-11H2,1-3H3 |
| InChIKey | RZBZTNSWCMYQOP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|