C17H21ClN2O — CID 114780841
6-(chloromethyl)-2,2-dimethyl-4-(2-methylquinolin-4-yl)morpholine (PubChem CID 114780841) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyl-4-(2-methylquinolin-4-yl)morpholine.
| Compound Name | 6-(chloromethyl)-2,2-dimethyl-4-(2-methylquinolin-4-yl)morpholine |
|---|---|
| PubChem CID | 114780841 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyl-4-(2-methylquinolin-4-yl)morpholine |
| SMILES | Cc1cc(N2CC(CCl)OC(C)(C)C2)c2ccccc2n1 |
| InChI | InChI=1S/C17H21ClN2O/c1-12-8-16(14-6-4-5-7-15(14)19-12)20-10-13(9-18)21-17(2,3)11-20/h4-8,13H,9-11H2,1-3H3 |
| InChIKey | AFYXDZBQOKZCFC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|