About 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine
6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine (PubChem CID 114780970) has the molecular formula C13H20BrN3O
and a molecular weight of 314.23 g/mol. Its IUPAC name is 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine |
| PubChem CID | 114780970 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine |
| SMILES | Cc1cc(C)nc(N2CC(CBr)OC(C)(C)C2)n1 |
| InChI | InChI=1S/C13H20BrN3O/c1-9-5-10(2)16-12(15-9)17-7-11(6-14)18-13(3,4)8-17/h5,11H,6-8H2,1-4H3 |
| InChIKey | AZJUQWJOJPYIIA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine?
The IUPAC name of 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine (CID 114780970) is 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine.
What is the SMILES notation for 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine?
The canonical SMILES for 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine is Cc1cc(C)nc(N2CC(CBr)OC(C)(C)C2)n1.
What is the InChIKey of 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine?
The InChIKey is AZJUQWJOJPYIIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BrN3O/c1-9-5-10(2)16-12(15-9)17-7-11(6-14)18-13(3,4)8-17/h5,11H,6-8H2,1-4H3.
What are the key properties of 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine?
6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine has a molecular weight of 314.23 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(bromomethyl)-4-(4,6-dimethylpyrimidin-2-yl)-2,2-dimethylmorpholine is sourced from PubChem (CID 114780970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).