C14H22BrN3O2 — CID 114780964
6-(bromomethyl)-2,2-dimethyl-4-(6-propoxypyrimidin-4-yl)morpholine (PubChem CID 114780964) has the molecular formula C14H22BrN3O2 and a molecular weight of 344.25 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-(6-propoxypyrimidin-4-yl)morpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-(6-propoxypyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 114780964 |
| Molecular Formula | C14H22BrN3O2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-(6-propoxypyrimidin-4-yl)morpholine |
| SMILES | CCCOc1cc(N2CC(CBr)OC(C)(C)C2)ncn1 |
| InChI | InChI=1S/C14H22BrN3O2/c1-4-5-19-13-6-12(16-10-17-13)18-8-11(7-15)20-14(2,3)9-18/h6,10-11H,4-5,7-9H2,1-3H3 |
| InChIKey | FSFWTQYKZSPMJJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|