C15H24BrN3O2 — CID 114781072
6-(bromomethyl)-2,2-dimethyl-4-(4-methyl-6-propoxypyrimidin-2-yl)morpholine (PubChem CID 114781072) has the molecular formula C15H24BrN3O2 and a molecular weight of 358.28 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-(4-methyl-6-propoxypyrimidin-2-yl)morpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-(4-methyl-6-propoxypyrimidin-2-yl)morpholine |
|---|---|
| PubChem CID | 114781072 |
| Molecular Formula | C15H24BrN3O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-(4-methyl-6-propoxypyrimidin-2-yl)morpholine |
| SMILES | CCCOc1cc(C)nc(N2CC(CBr)OC(C)(C)C2)n1 |
| InChI | InChI=1S/C15H24BrN3O2/c1-5-6-20-13-7-11(2)17-14(18-13)19-9-12(8-16)21-15(3,4)10-19/h7,12H,5-6,8-10H2,1-4H3 |
| InChIKey | ROXHDKGRQARKIL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|