C15H26N4OS — CID 115973341
[1-(4-methyl-6-propoxypyrimidin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine (PubChem CID 115973341) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is [1-(4-methyl-6-propoxypyrimidin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine.
| Compound Name | [1-(4-methyl-6-propoxypyrimidin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 115973341 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [1-(4-methyl-6-propoxypyrimidin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine |
| SMILES | CCCOc1cc(C)nc(N2CCC(CN)(SC)CC2)n1 |
| InChI | InChI=1S/C15H26N4OS/c1-4-9-20-13-10-12(2)17-14(18-13)19-7-5-15(11-16,21-3)6-8-19/h10H,4-9,11,16H2,1-3H3 |
| InChIKey | CFTPFJCXJVMVCG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |