C11H16BrN3O — CID 114780992
6-(bromomethyl)-2,2-dimethyl-4-pyrazin-2-ylmorpholine (PubChem CID 114780992) has the molecular formula C11H16BrN3O and a molecular weight of 286.17 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-pyrazin-2-ylmorpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-pyrazin-2-ylmorpholine |
|---|---|
| PubChem CID | 114780992 |
| Molecular Formula | C11H16BrN3O |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-pyrazin-2-ylmorpholine |
| SMILES | CC1(C)CN(c2cnccn2)CC(CBr)O1 |
| InChI | InChI=1S/C11H16BrN3O/c1-11(2)8-15(7-9(5-12)16-11)10-6-13-3-4-14-10/h3-4,6,9H,5,7-8H2,1-2H3 |
| InChIKey | BYPVAIXVMUSKCO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|