C12H18N4O2S — CID 114776973
3-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]pyrazine-2-carbothioamide (PubChem CID 114776973) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]pyrazine-2-carbothioamide.
| Compound Name | 3-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 114776973 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]pyrazine-2-carbothioamide |
| SMILES | CC1(C)CN(c2nccnc2C(N)=S)CC(CO)O1 |
| InChI | InChI=1S/C12H18N4O2S/c1-12(2)7-16(5-8(6-17)18-12)11-9(10(13)19)14-3-4-15-11/h3-4,8,17H,5-7H2,1-2H3,(H2,13,19) |
| InChIKey | FRCSNCFYGLWLQJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|