C14H19FN2O2S — CID 114776979
5-fluoro-2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]benzenecarbothioamide (PubChem CID 114776979) has the molecular formula C14H19FN2O2S and a molecular weight of 298.38 g/mol. Its IUPAC name is 5-fluoro-2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]benzenecarbothioamide.
| Compound Name | 5-fluoro-2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 114776979 |
| Molecular Formula | C14H19FN2O2S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-fluoro-2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]benzenecarbothioamide |
| SMILES | CC1(C)CN(c2ccc(F)cc2C(N)=S)CC(CO)O1 |
| InChI | InChI=1S/C14H19FN2O2S/c1-14(2)8-17(6-10(7-18)19-14)12-4-3-9(15)5-11(12)13(16)20/h3-5,10,18H,6-8H2,1-2H3,(H2,16,20) |
| InChIKey | ZFTVKHLDDPTGQA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|