C15H22N2O2S2 — CID 114776969
2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-6-methylsulfanylbenzenecarbothioamide (PubChem CID 114776969) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-6-methylsulfanylbenzenecarbothioamide.
| Compound Name | 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-6-methylsulfanylbenzenecarbothioamide |
|---|---|
| PubChem CID | 114776969 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-6-methylsulfanylbenzenecarbothioamide |
| SMILES | CSc1cccc(N2CC(CO)OC(C)(C)C2)c1C(N)=S |
| InChI | InChI=1S/C15H22N2O2S2/c1-15(2)9-17(7-10(8-18)19-15)11-5-4-6-12(21-3)13(11)14(16)20/h4-6,10,18H,7-9H2,1-3H3,(H2,16,20) |
| InChIKey | HPQZAWKETGVHKX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|