C14H20N2OS2 — CID 114797700
2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]-6-methylsulfanylbenzenecarbothioamide (PubChem CID 114797700) has the molecular formula C14H20N2OS2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]-6-methylsulfanylbenzenecarbothioamide.
| Compound Name | 2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]-6-methylsulfanylbenzenecarbothioamide |
|---|---|
| PubChem CID | 114797700 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]-6-methylsulfanylbenzenecarbothioamide |
| SMILES | CSc1cccc(N2CCC(CCO)C2)c1C(N)=S |
| InChI | InChI=1S/C14H20N2OS2/c1-19-12-4-2-3-11(13(12)14(15)18)16-7-5-10(9-16)6-8-17/h2-4,10,17H,5-9H2,1H3,(H2,15,18) |
| InChIKey | OFVGHOZMSYEQRD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|